C15H17ClN2O2 — CID 63549144
4-chloro-2-(2,4-dimethoxyphenyl)-6-ethyl-5-methylpyrimidine (PubChem CID 63549144) has the molecular formula C15H17ClN2O2 and a molecular weight of 292.77 g/mol. Its IUPAC name is 4-chloro-2-(2,4-dimethoxyphenyl)-6-ethyl-5-methylpyrimidine.
| Compound Name | 4-chloro-2-(2,4-dimethoxyphenyl)-6-ethyl-5-methylpyrimidine |
|---|---|
| PubChem CID | 63549144 |
| Molecular Formula | C15H17ClN2O2 |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 4-chloro-2-(2,4-dimethoxyphenyl)-6-ethyl-5-methylpyrimidine |
| SMILES | CCc1nc(-c2ccc(OC)cc2OC)nc(Cl)c1C |
| InChI | InChI=1S/C15H17ClN2O2/c1-5-12-9(2)14(16)18-15(17-12)11-7-6-10(19-3)8-13(11)20-4/h6-8H,5H2,1-4H3 |
| InChIKey | FFXQLWGVJBWRKO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |