C13H25N3O4 — CID 63550411
2-[[3-(diethylamino)pyrrolidine-1-carbonyl]amino]-4-hydroxybutanoic acid (PubChem CID 63550411) has the molecular formula C13H25N3O4 and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-[[3-(diethylamino)pyrrolidine-1-carbonyl]amino]-4-hydroxybutanoic acid.
| Compound Name | 2-[[3-(diethylamino)pyrrolidine-1-carbonyl]amino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 63550411 |
| Molecular Formula | C13H25N3O4 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | 2-[[3-(diethylamino)pyrrolidine-1-carbonyl]amino]-4-hydroxybutanoic acid |
| SMILES | CCN(CC)C1CCN(C(=O)NC(CCO)C(=O)O)C1 |
| InChI | InChI=1S/C13H25N3O4/c1-3-15(4-2)10-5-7-16(9-10)13(20)14-11(6-8-17)12(18)19/h10-11,17H,3-9H2,1-2H3,(H,14,20)(H,18,19) |
| InChIKey | QDBXVBUMIWKLIP-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |