C17H23BrN2S — CID 63551371
5-bromo-2-(ethylaminomethyl)-N-propan-2-yl-N-(thiophen-2-ylmethyl)aniline (PubChem CID 63551371) has the molecular formula C17H23BrN2S and a molecular weight of 367.36 g/mol. Its IUPAC name is 5-bromo-2-(ethylaminomethyl)-N-propan-2-yl-N-(thiophen-2-ylmethyl)aniline.
| Compound Name | 5-bromo-2-(ethylaminomethyl)-N-propan-2-yl-N-(thiophen-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 63551371 |
| Molecular Formula | C17H23BrN2S |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 5-bromo-2-(ethylaminomethyl)-N-propan-2-yl-N-(thiophen-2-ylmethyl)aniline |
| SMILES | CCNCc1ccc(Br)cc1N(Cc1cccs1)C(C)C |
| InChI | InChI=1S/C17H23BrN2S/c1-4-19-11-14-7-8-15(18)10-17(14)20(13(2)3)12-16-6-5-9-21-16/h5-10,13,19H,4,11-12H2,1-3H3 |
| InChIKey | FYFPYAJVYUOBNV-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |