C16H17ClFNO — CID 63551840
N-[[4-(2-chloro-4-fluorophenoxy)phenyl]methyl]propan-1-amine (PubChem CID 63551840) has the molecular formula C16H17ClFNO and a molecular weight of 293.77 g/mol. Its IUPAC name is N-[[4-(2-chloro-4-fluorophenoxy)phenyl]methyl]propan-1-amine.
| Compound Name | N-[[4-(2-chloro-4-fluorophenoxy)phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 63551840 |
| Molecular Formula | C16H17ClFNO |
| Molecular Weight | 293.77 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | N-[[4-(2-chloro-4-fluorophenoxy)phenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(Oc2ccc(F)cc2Cl)cc1 |
| InChI | InChI=1S/C16H17ClFNO/c1-2-9-19-11-12-3-6-14(7-4-12)20-16-8-5-13(18)10-15(16)17/h3-8,10,19H,2,9,11H2,1H3 |
| InChIKey | QTNNBZGIRVCZMF-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.77 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|