C17H28F2N2 — CID 63551898
4-[(tert-butylamino)methyl]-2,6-difluoro-N-methyl-N-(3-methylbutan-2-yl)aniline (PubChem CID 63551898) has the molecular formula C17H28F2N2 and a molecular weight of 298.42 g/mol. Its IUPAC name is 4-[(tert-butylamino)methyl]-2,6-difluoro-N-methyl-N-(3-methylbutan-2-yl)aniline.
| Compound Name | 4-[(tert-butylamino)methyl]-2,6-difluoro-N-methyl-N-(3-methylbutan-2-yl)aniline |
|---|---|
| PubChem CID | 63551898 |
| Molecular Formula | C17H28F2N2 |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | 4-[(tert-butylamino)methyl]-2,6-difluoro-N-methyl-N-(3-methylbutan-2-yl)aniline |
| SMILES | CC(C)C(C)N(C)c1c(F)cc(CNC(C)(C)C)cc1F |
| InChI | InChI=1S/C17H28F2N2/c1-11(2)12(3)21(7)16-14(18)8-13(9-15(16)19)10-20-17(4,5)6/h8-9,11-12,20H,10H2,1-7H3 |
| InChIKey | TWJZJSDSWWDZJT-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|