C18H32N2 — CID 63552325
N-(2,2-dimethylpropyl)-N,3-dimethyl-4-[(2-methylpropylamino)methyl]aniline (PubChem CID 63552325) has the molecular formula C18H32N2 and a molecular weight of 276.47 g/mol. Its IUPAC name is N-(2,2-dimethylpropyl)-N,3-dimethyl-4-[(2-methylpropylamino)methyl]aniline.
| Compound Name | N-(2,2-dimethylpropyl)-N,3-dimethyl-4-[(2-methylpropylamino)methyl]aniline |
|---|---|
| PubChem CID | 63552325 |
| Molecular Formula | C18H32N2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.26 |
| IUPAC Name | N-(2,2-dimethylpropyl)-N,3-dimethyl-4-[(2-methylpropylamino)methyl]aniline |
| SMILES | Cc1cc(N(C)CC(C)(C)C)ccc1CNCC(C)C |
| InChI | InChI=1S/C18H32N2/c1-14(2)11-19-12-16-8-9-17(10-15(16)3)20(7)13-18(4,5)6/h8-10,14,19H,11-13H2,1-7H3 |
| InChIKey | OOBMHOQUBMDJII-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|