C14H15NO — CID 63553709
2-cyclopropyl-1-(5-methyl-1H-indol-3-yl)ethanone (PubChem CID 63553709) has the molecular formula C14H15NO and a molecular weight of 213.28 g/mol. Its IUPAC name is 2-cyclopropyl-1-(5-methyl-1H-indol-3-yl)ethanone.
| Compound Name | 2-cyclopropyl-1-(5-methyl-1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 63553709 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 2-cyclopropyl-1-(5-methyl-1H-indol-3-yl)ethanone |
| SMILES | Cc1ccc2[nH]cc(C(=O)CC3CC3)c2c1 |
| InChI | InChI=1S/C14H15NO/c1-9-2-5-13-11(6-9)12(8-15-13)14(16)7-10-3-4-10/h2,5-6,8,10,15H,3-4,7H2,1H3 |
| InChIKey | SHEKFJKAUYYWGO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |