C13H17NO — CID 63555756
2-cyclopentyl-1-(6-methyl-2-pyridinyl)ethanone (PubChem CID 63555756) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is 2-cyclopentyl-1-(6-methyl-2-pyridinyl)ethanone.
| Compound Name | 2-cyclopentyl-1-(6-methyl-2-pyridinyl)ethanone |
|---|---|
| PubChem CID | 63555756 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 2-cyclopentyl-1-(6-methyl-2-pyridinyl)ethanone |
| SMILES | Cc1cccc(C(=O)CC2CCCC2)n1 |
| InChI | InChI=1S/C13H17NO/c1-10-5-4-8-12(14-10)13(15)9-11-6-2-3-7-11/h4-5,8,11H,2-3,6-7,9H2,1H3 |
| InChIKey | KMMVWLKFIKUHEY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |