C27H25FN2O7 — CID 6355592
2-[[(E)-3-(4-fluorophenyl)-2-[(3,4,5-trimethoxybenzoyl)amino]prop-2-enoyl]amino]-2-phenylacetic acid (PubChem CID 6355592) has the molecular formula C27H25FN2O7 and a molecular weight of 508.50 g/mol. Its IUPAC name is 2-[[(E)-3-(4-fluorophenyl)-2-[(3,4,5-trimethoxybenzoyl)amino]prop-2-enoyl]amino]-2-phenylacetic acid.
| Compound Name | 2-[[(E)-3-(4-fluorophenyl)-2-[(3,4,5-trimethoxybenzoyl)amino]prop-2-enoyl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 6355592 |
| Molecular Formula | C27H25FN2O7 |
| Molecular Weight | 508.50 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | 2-[[(E)-3-(4-fluorophenyl)-2-[(3,4,5-trimethoxybenzoyl)amino]prop-2-enoyl]amino]-2-phenylacetic acid |
| SMILES | COc1cc(C(=O)N/C(=C/c2ccc(F)cc2)C(=O)NC(C(=O)O)c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C27H25FN2O7/c1-35-21-14-18(15-22(36-2)24(21)37-3)25(31)29-20(13-16-9-11-19(28)12-10-16)26(32)30-23(27(33)34)17-7-5-4-6-8-17/h4-15,23H,1-3H3,(H,29,31)(H,30,32)(H,33,34)/b20-13+ |
| InChIKey | GMPAFQSTFARHFP-DEDYPNTBSA-N |
| XLogP | 3.56 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|