About oxolan-3-yl 2-(propylamino)acetate
oxolan-3-yl 2-(propylamino)acetate (PubChem CID 63556873) has the molecular formula C9H17NO3
and a molecular weight of 187.24 g/mol. Its IUPAC name is oxolan-3-yl 2-(propylamino)acetate.
Molecular Properties
| Compound Name | oxolan-3-yl 2-(propylamino)acetate |
| PubChem CID | 63556873 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | oxolan-3-yl 2-(propylamino)acetate |
| SMILES | CCCNCC(=O)OC1CCOC1 |
| InChI | InChI=1S/C9H17NO3/c1-2-4-10-6-9(11)13-8-3-5-12-7-8/h8,10H,2-7H2,1H3 |
| InChIKey | WOZNKSGNWCCMFH-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze oxolan-3-yl 2-(propylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolan-3-yl 2-(propylamino)acetate?
The IUPAC name of oxolan-3-yl 2-(propylamino)acetate (CID 63556873) is oxolan-3-yl 2-(propylamino)acetate.
What is the SMILES notation for oxolan-3-yl 2-(propylamino)acetate?
The canonical SMILES for oxolan-3-yl 2-(propylamino)acetate is CCCNCC(=O)OC1CCOC1.
What is the InChIKey of oxolan-3-yl 2-(propylamino)acetate?
The InChIKey is WOZNKSGNWCCMFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO3/c1-2-4-10-6-9(11)13-8-3-5-12-7-8/h8,10H,2-7H2,1H3.
What are the key properties of oxolan-3-yl 2-(propylamino)acetate?
oxolan-3-yl 2-(propylamino)acetate has a molecular weight of 187.24 g/mol, XLogP of 0.32, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxolan-3-yl 2-(propylamino)acetate is sourced from PubChem (CID 63556873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).