About 4-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]-1,3-thiazole-2-carboxylic acid
4-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]-1,3-thiazole-2-carboxylic acid (PubChem CID 63557188) has the molecular formula C9H6FN3O4S
and a molecular weight of 271.23 g/mol. Its IUPAC name is 4-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]-1,3-thiazole-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]-1,3-thiazole-2-carboxylic acid |
| PubChem CID | 63557188 |
| Molecular Formula | C9H6FN3O4S |
| Molecular Weight | 271.23 g/mol |
| Exact Mass | 271.01 |
| IUPAC Name | 4-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]-1,3-thiazole-2-carboxylic acid |
| SMILES | O=C(O)c1nc(Cn2cc(F)c(=O)[nH]c2=O)cs1 |
| InChI | InChI=1S/C9H6FN3O4S/c10-5-2-13(9(17)12-6(5)14)1-4-3-18-7(11-4)8(15)16/h2-3H,1H2,(H,15,16)(H,12,14,17) |
| InChIKey | YGJZKHGSXZSYLA-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.23 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]-1,3-thiazole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]-1,3-thiazole-2-carboxylic acid?
The IUPAC name of 4-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]-1,3-thiazole-2-carboxylic acid (CID 63557188) is 4-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]-1,3-thiazole-2-carboxylic acid.
What is the SMILES notation for 4-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]-1,3-thiazole-2-carboxylic acid?
The canonical SMILES for 4-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]-1,3-thiazole-2-carboxylic acid is O=C(O)c1nc(Cn2cc(F)c(=O)[nH]c2=O)cs1.
What is the InChIKey of 4-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]-1,3-thiazole-2-carboxylic acid?
The InChIKey is YGJZKHGSXZSYLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6FN3O4S/c10-5-2-13(9(17)12-6(5)14)1-4-3-18-7(11-4)8(15)16/h2-3H,1H2,(H,15,16)(H,12,14,17).
What are the key properties of 4-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]-1,3-thiazole-2-carboxylic acid?
4-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]-1,3-thiazole-2-carboxylic acid has a molecular weight of 271.23 g/mol, XLogP of -0.12, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methyl]-1,3-thiazole-2-carboxylic acid is sourced from PubChem (CID 63557188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).