About (2S,5S)-2,5-dimethyl-1-prop-2-ynylpiperidin-4-one
(2S,5S)-2,5-dimethyl-1-prop-2-ynylpiperidin-4-one (PubChem CID 6355719) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is (2S,5S)-2,5-dimethyl-1-prop-2-ynylpiperidin-4-one.
Molecular Properties
| Compound Name | (2S,5S)-2,5-dimethyl-1-prop-2-ynylpiperidin-4-one |
| PubChem CID | 6355719 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (2S,5S)-2,5-dimethyl-1-prop-2-ynylpiperidin-4-one |
| SMILES | C#CCN1C[C@H](C)C(=O)C[C@@H]1C |
| InChI | InChI=1S/C10H15NO/c1-4-5-11-7-8(2)10(12)6-9(11)3/h1,8-9H,5-7H2,2-3H3/t8-,9-/m0/s1 |
| InChIKey | QKOONSQMCOIEKG-IUCAKERBSA-N |
| XLogP | 0.92 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S,5S)-2,5-dimethyl-1-prop-2-ynylpiperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5S)-2,5-dimethyl-1-prop-2-ynylpiperidin-4-one?
The IUPAC name of (2S,5S)-2,5-dimethyl-1-prop-2-ynylpiperidin-4-one (CID 6355719) is (2S,5S)-2,5-dimethyl-1-prop-2-ynylpiperidin-4-one.
What is the SMILES notation for (2S,5S)-2,5-dimethyl-1-prop-2-ynylpiperidin-4-one?
The canonical SMILES for (2S,5S)-2,5-dimethyl-1-prop-2-ynylpiperidin-4-one is C#CCN1C[C@H](C)C(=O)C[C@@H]1C.
What is the InChIKey of (2S,5S)-2,5-dimethyl-1-prop-2-ynylpiperidin-4-one?
The InChIKey is QKOONSQMCOIEKG-IUCAKERBSA-N. The full InChI is InChI=1S/C10H15NO/c1-4-5-11-7-8(2)10(12)6-9(11)3/h1,8-9H,5-7H2,2-3H3/t8-,9-/m0/s1.
What are the key properties of (2S,5S)-2,5-dimethyl-1-prop-2-ynylpiperidin-4-one?
(2S,5S)-2,5-dimethyl-1-prop-2-ynylpiperidin-4-one has a molecular weight of 165.24 g/mol, XLogP of 0.92, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5S)-2,5-dimethyl-1-prop-2-ynylpiperidin-4-one is sourced from PubChem (CID 6355719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).