About 3-[4-(bromomethyl)-2,6-dimethylphenoxy]oxolane
3-[4-(bromomethyl)-2,6-dimethylphenoxy]oxolane (PubChem CID 63557572) has the molecular formula C13H17BrO2
and a molecular weight of 285.18 g/mol. Its IUPAC name is 3-[4-(bromomethyl)-2,6-dimethylphenoxy]oxolane.
Molecular Properties
| Compound Name | 3-[4-(bromomethyl)-2,6-dimethylphenoxy]oxolane |
| PubChem CID | 63557572 |
| Molecular Formula | C13H17BrO2 |
| Molecular Weight | 285.18 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 3-[4-(bromomethyl)-2,6-dimethylphenoxy]oxolane |
| SMILES | Cc1cc(CBr)cc(C)c1OC1CCOC1 |
| InChI | InChI=1S/C13H17BrO2/c1-9-5-11(7-14)6-10(2)13(9)16-12-3-4-15-8-12/h5-6,12H,3-4,7-8H2,1-2H3 |
| InChIKey | YUWMQYAHWPWCSH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.18 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(bromomethyl)-2,6-dimethylphenoxy]oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(bromomethyl)-2,6-dimethylphenoxy]oxolane?
The IUPAC name of 3-[4-(bromomethyl)-2,6-dimethylphenoxy]oxolane (CID 63557572) is 3-[4-(bromomethyl)-2,6-dimethylphenoxy]oxolane.
What is the SMILES notation for 3-[4-(bromomethyl)-2,6-dimethylphenoxy]oxolane?
The canonical SMILES for 3-[4-(bromomethyl)-2,6-dimethylphenoxy]oxolane is Cc1cc(CBr)cc(C)c1OC1CCOC1.
What is the InChIKey of 3-[4-(bromomethyl)-2,6-dimethylphenoxy]oxolane?
The InChIKey is YUWMQYAHWPWCSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17BrO2/c1-9-5-11(7-14)6-10(2)13(9)16-12-3-4-15-8-12/h5-6,12H,3-4,7-8H2,1-2H3.
What are the key properties of 3-[4-(bromomethyl)-2,6-dimethylphenoxy]oxolane?
3-[4-(bromomethyl)-2,6-dimethylphenoxy]oxolane has a molecular weight of 285.18 g/mol, XLogP of 3.37, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(bromomethyl)-2,6-dimethylphenoxy]oxolane is sourced from PubChem (CID 63557572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).