C10H14FN3O2 — CID 63557590
5-fluoro-1-(piperidin-3-ylmethyl)pyrimidine-2,4-dione (PubChem CID 63557590) has the molecular formula C10H14FN3O2 and a molecular weight of 227.24 g/mol. Its IUPAC name is 5-fluoro-1-(piperidin-3-ylmethyl)pyrimidine-2,4-dione.
| Compound Name | 5-fluoro-1-(piperidin-3-ylmethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 63557590 |
| Molecular Formula | C10H14FN3O2 |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 5-fluoro-1-(piperidin-3-ylmethyl)pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(CC2CCCNC2)cc1F |
| InChI | InChI=1S/C10H14FN3O2/c11-8-6-14(10(16)13-9(8)15)5-7-2-1-3-12-4-7/h6-7,12H,1-5H2,(H,13,15,16) |
| InChIKey | MAVYZGYMJOWOMN-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |