C12H12F3NO2S — CID 63558040
4-(oxolan-3-yloxy)-2-(trifluoromethyl)benzenecarbothioamide (PubChem CID 63558040) has the molecular formula C12H12F3NO2S and a molecular weight of 291.29 g/mol. Its IUPAC name is 4-(oxolan-3-yloxy)-2-(trifluoromethyl)benzenecarbothioamide.
| Compound Name | 4-(oxolan-3-yloxy)-2-(trifluoromethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 63558040 |
| Molecular Formula | C12H12F3NO2S |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 4-(oxolan-3-yloxy)-2-(trifluoromethyl)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(OC2CCOC2)cc1C(F)(F)F |
| InChI | InChI=1S/C12H12F3NO2S/c13-12(14,15)10-5-7(1-2-9(10)11(16)19)18-8-3-4-17-6-8/h1-2,5,8H,3-4,6H2,(H2,16,19) |
| InChIKey | ZILOUNAHQIYZOW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|