C12H16FNO2 — CID 63558652
(1R)-1-[3-fluoro-4-(oxolan-3-yloxy)phenyl]ethanamine (PubChem CID 63558652) has the molecular formula C12H16FNO2 and a molecular weight of 225.26 g/mol. Its IUPAC name is (1R)-1-[3-fluoro-4-(oxolan-3-yloxy)phenyl]ethanamine.
| Compound Name | (1R)-1-[3-fluoro-4-(oxolan-3-yloxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 63558652 |
| Molecular Formula | C12H16FNO2 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | (1R)-1-[3-fluoro-4-(oxolan-3-yloxy)phenyl]ethanamine |
| SMILES | C[C@@H](N)c1ccc(OC2CCOC2)c(F)c1 |
| InChI | InChI=1S/C12H16FNO2/c1-8(14)9-2-3-12(11(13)6-9)16-10-4-5-15-7-10/h2-3,6,8,10H,4-5,7,14H2,1H3/t8-,10?/m1/s1 |
| InChIKey | UZKMCZPPJYJTEG-HNHGDDPOSA-N |
| XLogP | 2.01 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |