About 2-butan-2-yl-6-ethyl-N,5-dimethylpyrimidin-4-amine
2-butan-2-yl-6-ethyl-N,5-dimethylpyrimidin-4-amine (PubChem CID 63560396) has the molecular formula C12H21N3
and a molecular weight of 207.32 g/mol. Its IUPAC name is 2-butan-2-yl-6-ethyl-N,5-dimethylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-butan-2-yl-6-ethyl-N,5-dimethylpyrimidin-4-amine |
| PubChem CID | 63560396 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 2-butan-2-yl-6-ethyl-N,5-dimethylpyrimidin-4-amine |
| SMILES | CCc1nc(C(C)CC)nc(NC)c1C |
| InChI | InChI=1S/C12H21N3/c1-6-8(3)11-14-10(7-2)9(4)12(13-5)15-11/h8H,6-7H2,1-5H3,(H,13,14,15) |
| InChIKey | JYYHCZPZRNHABC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-butan-2-yl-6-ethyl-N,5-dimethylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-yl-6-ethyl-N,5-dimethylpyrimidin-4-amine?
The IUPAC name of 2-butan-2-yl-6-ethyl-N,5-dimethylpyrimidin-4-amine (CID 63560396) is 2-butan-2-yl-6-ethyl-N,5-dimethylpyrimidin-4-amine.
What is the SMILES notation for 2-butan-2-yl-6-ethyl-N,5-dimethylpyrimidin-4-amine?
The canonical SMILES for 2-butan-2-yl-6-ethyl-N,5-dimethylpyrimidin-4-amine is CCc1nc(C(C)CC)nc(NC)c1C.
What is the InChIKey of 2-butan-2-yl-6-ethyl-N,5-dimethylpyrimidin-4-amine?
The InChIKey is JYYHCZPZRNHABC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3/c1-6-8(3)11-14-10(7-2)9(4)12(13-5)15-11/h8H,6-7H2,1-5H3,(H,13,14,15).
What are the key properties of 2-butan-2-yl-6-ethyl-N,5-dimethylpyrimidin-4-amine?
2-butan-2-yl-6-ethyl-N,5-dimethylpyrimidin-4-amine has a molecular weight of 207.32 g/mol, XLogP of 2.90, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-yl-6-ethyl-N,5-dimethylpyrimidin-4-amine is sourced from PubChem (CID 63560396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).