C14H24N2O2 — CID 63560469
2-[3-(3-methylcyclohexyl)-1,2,4-oxadiazol-5-yl]pentan-3-ol (PubChem CID 63560469) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 2-[3-(3-methylcyclohexyl)-1,2,4-oxadiazol-5-yl]pentan-3-ol.
| Compound Name | 2-[3-(3-methylcyclohexyl)-1,2,4-oxadiazol-5-yl]pentan-3-ol |
|---|---|
| PubChem CID | 63560469 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 2-[3-(3-methylcyclohexyl)-1,2,4-oxadiazol-5-yl]pentan-3-ol |
| SMILES | CCC(O)C(C)c1nc(C2CCCC(C)C2)no1 |
| InChI | InChI=1S/C14H24N2O2/c1-4-12(17)10(3)14-15-13(16-18-14)11-7-5-6-9(2)8-11/h9-12,17H,4-8H2,1-3H3 |
| InChIKey | LIDRRPSMPLMIQE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |