About 2-ethyl-5,6,8-trifluoro-3-methyl-1H-quinolin-4-one
2-ethyl-5,6,8-trifluoro-3-methyl-1H-quinolin-4-one (PubChem CID 63561305) has the molecular formula C12H10F3NO
and a molecular weight of 241.21 g/mol. Its IUPAC name is 2-ethyl-5,6,8-trifluoro-3-methyl-1H-quinolin-4-one.
Molecular Properties
| Compound Name | 2-ethyl-5,6,8-trifluoro-3-methyl-1H-quinolin-4-one |
| PubChem CID | 63561305 |
| Molecular Formula | C12H10F3NO |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 2-ethyl-5,6,8-trifluoro-3-methyl-1H-quinolin-4-one |
| SMILES | CCc1[nH]c2c(F)cc(F)c(F)c2c(=O)c1C |
| InChI | InChI=1S/C12H10F3NO/c1-3-8-5(2)12(17)9-10(15)6(13)4-7(14)11(9)16-8/h4H,3H2,1-2H3,(H,16,17) |
| InChIKey | WTOLXPQJPMBNQW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-5,6,8-trifluoro-3-methyl-1H-quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-5,6,8-trifluoro-3-methyl-1H-quinolin-4-one?
The IUPAC name of 2-ethyl-5,6,8-trifluoro-3-methyl-1H-quinolin-4-one (CID 63561305) is 2-ethyl-5,6,8-trifluoro-3-methyl-1H-quinolin-4-one.
What is the SMILES notation for 2-ethyl-5,6,8-trifluoro-3-methyl-1H-quinolin-4-one?
The canonical SMILES for 2-ethyl-5,6,8-trifluoro-3-methyl-1H-quinolin-4-one is CCc1[nH]c2c(F)cc(F)c(F)c2c(=O)c1C.
What is the InChIKey of 2-ethyl-5,6,8-trifluoro-3-methyl-1H-quinolin-4-one?
The InChIKey is WTOLXPQJPMBNQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F3NO/c1-3-8-5(2)12(17)9-10(15)6(13)4-7(14)11(9)16-8/h4H,3H2,1-2H3,(H,16,17).
What are the key properties of 2-ethyl-5,6,8-trifluoro-3-methyl-1H-quinolin-4-one?
2-ethyl-5,6,8-trifluoro-3-methyl-1H-quinolin-4-one has a molecular weight of 241.21 g/mol, XLogP of 2.82, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-5,6,8-trifluoro-3-methyl-1H-quinolin-4-one is sourced from PubChem (CID 63561305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).