About 4-chloro-2-ethyl-3,5,7-trimethylquinoline
4-chloro-2-ethyl-3,5,7-trimethylquinoline (PubChem CID 63561497) has the molecular formula C14H16ClN
and a molecular weight of 233.74 g/mol. Its IUPAC name is 4-chloro-2-ethyl-3,5,7-trimethylquinoline.
Molecular Properties
| Compound Name | 4-chloro-2-ethyl-3,5,7-trimethylquinoline |
| PubChem CID | 63561497 |
| Molecular Formula | C14H16ClN |
| Molecular Weight | 233.74 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 4-chloro-2-ethyl-3,5,7-trimethylquinoline |
| SMILES | CCc1nc2cc(C)cc(C)c2c(Cl)c1C |
| InChI | InChI=1S/C14H16ClN/c1-5-11-10(4)14(15)13-9(3)6-8(2)7-12(13)16-11/h6-7H,5H2,1-4H3 |
| InChIKey | DVZUCMJNPCWYAT-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.74 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-chloro-2-ethyl-3,5,7-trimethylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-ethyl-3,5,7-trimethylquinoline?
The IUPAC name of 4-chloro-2-ethyl-3,5,7-trimethylquinoline (CID 63561497) is 4-chloro-2-ethyl-3,5,7-trimethylquinoline.
What is the SMILES notation for 4-chloro-2-ethyl-3,5,7-trimethylquinoline?
The canonical SMILES for 4-chloro-2-ethyl-3,5,7-trimethylquinoline is CCc1nc2cc(C)cc(C)c2c(Cl)c1C.
What is the InChIKey of 4-chloro-2-ethyl-3,5,7-trimethylquinoline?
The InChIKey is DVZUCMJNPCWYAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16ClN/c1-5-11-10(4)14(15)13-9(3)6-8(2)7-12(13)16-11/h6-7H,5H2,1-4H3.
What are the key properties of 4-chloro-2-ethyl-3,5,7-trimethylquinoline?
4-chloro-2-ethyl-3,5,7-trimethylquinoline has a molecular weight of 233.74 g/mol, XLogP of 4.38, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-ethyl-3,5,7-trimethylquinoline is sourced from PubChem (CID 63561497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).