C14H16N2O2 — CID 63561813
2-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]pentan-3-one (PubChem CID 63561813) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is 2-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]pentan-3-one.
| Compound Name | 2-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]pentan-3-one |
|---|---|
| PubChem CID | 63561813 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 2-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]pentan-3-one |
| SMILES | CCC(=O)C(C)c1nc(-c2cccc(C)c2)no1 |
| InChI | InChI=1S/C14H16N2O2/c1-4-12(17)10(3)14-15-13(16-18-14)11-7-5-6-9(2)8-11/h5-8,10H,4H2,1-3H3 |
| InChIKey | KMCCNKQFLMEHLV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |