About 4-chloro-2-ethyl-5,6,7-trimethoxy-3-methylquinoline
4-chloro-2-ethyl-5,6,7-trimethoxy-3-methylquinoline (PubChem CID 63561861) has the molecular formula C15H18ClNO3
and a molecular weight of 295.77 g/mol. Its IUPAC name is 4-chloro-2-ethyl-5,6,7-trimethoxy-3-methylquinoline.
Molecular Properties
| Compound Name | 4-chloro-2-ethyl-5,6,7-trimethoxy-3-methylquinoline |
| PubChem CID | 63561861 |
| Molecular Formula | C15H18ClNO3 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 4-chloro-2-ethyl-5,6,7-trimethoxy-3-methylquinoline |
| SMILES | CCc1nc2cc(OC)c(OC)c(OC)c2c(Cl)c1C |
| InChI | InChI=1S/C15H18ClNO3/c1-6-9-8(2)13(16)12-10(17-9)7-11(18-3)14(19-4)15(12)20-5/h7H,6H2,1-5H3 |
| InChIKey | FCBUTAPBXCXQEH-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-2-ethyl-5,6,7-trimethoxy-3-methylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-ethyl-5,6,7-trimethoxy-3-methylquinoline?
The IUPAC name of 4-chloro-2-ethyl-5,6,7-trimethoxy-3-methylquinoline (CID 63561861) is 4-chloro-2-ethyl-5,6,7-trimethoxy-3-methylquinoline.
What is the SMILES notation for 4-chloro-2-ethyl-5,6,7-trimethoxy-3-methylquinoline?
The canonical SMILES for 4-chloro-2-ethyl-5,6,7-trimethoxy-3-methylquinoline is CCc1nc2cc(OC)c(OC)c(OC)c2c(Cl)c1C.
What is the InChIKey of 4-chloro-2-ethyl-5,6,7-trimethoxy-3-methylquinoline?
The InChIKey is FCBUTAPBXCXQEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18ClNO3/c1-6-9-8(2)13(16)12-10(17-9)7-11(18-3)14(19-4)15(12)20-5/h7H,6H2,1-5H3.
What are the key properties of 4-chloro-2-ethyl-5,6,7-trimethoxy-3-methylquinoline?
4-chloro-2-ethyl-5,6,7-trimethoxy-3-methylquinoline has a molecular weight of 295.77 g/mol, XLogP of 3.78, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-ethyl-5,6,7-trimethoxy-3-methylquinoline is sourced from PubChem (CID 63561861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).