About 2-(cyclohexen-1-yl)-N,N-bis(2-hydroxyethyl)acetamide
2-(cyclohexen-1-yl)-N,N-bis(2-hydroxyethyl)acetamide (PubChem CID 63563088) has the molecular formula C12H21NO3
and a molecular weight of 227.30 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-N,N-bis(2-hydroxyethyl)acetamide.
Molecular Properties
| Compound Name | 2-(cyclohexen-1-yl)-N,N-bis(2-hydroxyethyl)acetamide |
| PubChem CID | 63563088 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 2-(cyclohexen-1-yl)-N,N-bis(2-hydroxyethyl)acetamide |
| SMILES | O=C(CC1=CCCCC1)N(CCO)CCO |
| InChI | InChI=1S/C12H21NO3/c14-8-6-13(7-9-15)12(16)10-11-4-2-1-3-5-11/h4,14-15H,1-3,5-10H2 |
| InChIKey | BXEYJXIPXGGXRF-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(cyclohexen-1-yl)-N,N-bis(2-hydroxyethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclohexen-1-yl)-N,N-bis(2-hydroxyethyl)acetamide?
The IUPAC name of 2-(cyclohexen-1-yl)-N,N-bis(2-hydroxyethyl)acetamide (CID 63563088) is 2-(cyclohexen-1-yl)-N,N-bis(2-hydroxyethyl)acetamide.
What is the SMILES notation for 2-(cyclohexen-1-yl)-N,N-bis(2-hydroxyethyl)acetamide?
The canonical SMILES for 2-(cyclohexen-1-yl)-N,N-bis(2-hydroxyethyl)acetamide is O=C(CC1=CCCCC1)N(CCO)CCO.
What is the InChIKey of 2-(cyclohexen-1-yl)-N,N-bis(2-hydroxyethyl)acetamide?
The InChIKey is BXEYJXIPXGGXRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO3/c14-8-6-13(7-9-15)12(16)10-11-4-2-1-3-5-11/h4,14-15H,1-3,5-10H2.
What are the key properties of 2-(cyclohexen-1-yl)-N,N-bis(2-hydroxyethyl)acetamide?
2-(cyclohexen-1-yl)-N,N-bis(2-hydroxyethyl)acetamide has a molecular weight of 227.30 g/mol, XLogP of 0.69, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclohexen-1-yl)-N,N-bis(2-hydroxyethyl)acetamide is sourced from PubChem (CID 63563088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).