C14H18N2O2 — CID 63565455
3,4-dihydro-2H-chromen-3-yl(piperazin-1-yl)methanone (PubChem CID 63565455) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromen-3-yl(piperazin-1-yl)methanone.
| Compound Name | 3,4-dihydro-2H-chromen-3-yl(piperazin-1-yl)methanone |
|---|---|
| PubChem CID | 63565455 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 3,4-dihydro-2H-chromen-3-yl(piperazin-1-yl)methanone |
| SMILES | O=C(C1COc2ccccc2C1)N1CCNCC1 |
| InChI | InChI=1S/C14H18N2O2/c17-14(16-7-5-15-6-8-16)12-9-11-3-1-2-4-13(11)18-10-12/h1-4,12,15H,5-10H2 |
| InChIKey | KEODCZSQSZDFTN-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |