C15H11Br2NOS — CID 63565804
1-(2,5-dibromothiophen-3-yl)-2-(3-methylindol-1-yl)ethanone (PubChem CID 63565804) has the molecular formula C15H11Br2NOS and a molecular weight of 413.13 g/mol. Its IUPAC name is 1-(2,5-dibromothiophen-3-yl)-2-(3-methylindol-1-yl)ethanone.
| Compound Name | 1-(2,5-dibromothiophen-3-yl)-2-(3-methylindol-1-yl)ethanone |
|---|---|
| PubChem CID | 63565804 |
| Molecular Formula | C15H11Br2NOS |
| Molecular Weight | 413.13 g/mol |
| Exact Mass | 410.89 |
| IUPAC Name | 1-(2,5-dibromothiophen-3-yl)-2-(3-methylindol-1-yl)ethanone |
| SMILES | Cc1cn(CC(=O)c2cc(Br)sc2Br)c2ccccc12 |
| InChI | InChI=1S/C15H11Br2NOS/c1-9-7-18(12-5-3-2-4-10(9)12)8-13(19)11-6-14(16)20-15(11)17/h2-7H,8H2,1H3 |
| InChIKey | QWQRMEMPAFZJDH-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.13 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |