C16H16Cl2N2O — CID 63566798
1-cyclohexyl-3-(3,4-dichlorophenyl)pyrazole-4-carbaldehyde (PubChem CID 63566798) has the molecular formula C16H16Cl2N2O and a molecular weight of 323.22 g/mol. Its IUPAC name is 1-cyclohexyl-3-(3,4-dichlorophenyl)pyrazole-4-carbaldehyde.
| Compound Name | 1-cyclohexyl-3-(3,4-dichlorophenyl)pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 63566798 |
| Molecular Formula | C16H16Cl2N2O |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 1-cyclohexyl-3-(3,4-dichlorophenyl)pyrazole-4-carbaldehyde |
| SMILES | O=Cc1cn(C2CCCCC2)nc1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H16Cl2N2O/c17-14-7-6-11(8-15(14)18)16-12(10-21)9-20(19-16)13-4-2-1-3-5-13/h6-10,13H,1-5H2 |
| InChIKey | UJKARIKCGIIVTL-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|