C12H14ClF4N — CID 63567113
2-(chloromethyl)-4-fluoro-N-propyl-N-(2,2,2-trifluoroethyl)aniline (PubChem CID 63567113) has the molecular formula C12H14ClF4N and a molecular weight of 283.70 g/mol. Its IUPAC name is 2-(chloromethyl)-4-fluoro-N-propyl-N-(2,2,2-trifluoroethyl)aniline.
| Compound Name | 2-(chloromethyl)-4-fluoro-N-propyl-N-(2,2,2-trifluoroethyl)aniline |
|---|---|
| PubChem CID | 63567113 |
| Molecular Formula | C12H14ClF4N |
| Molecular Weight | 283.70 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 2-(chloromethyl)-4-fluoro-N-propyl-N-(2,2,2-trifluoroethyl)aniline |
| SMILES | CCCN(CC(F)(F)F)c1ccc(F)cc1CCl |
| InChI | InChI=1S/C12H14ClF4N/c1-2-5-18(8-12(15,16)17)11-4-3-10(14)6-9(11)7-13/h3-4,6H,2,5,7-8H2,1H3 |
| InChIKey | DRTCVQBDVLOUBM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.70 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|