C16H13Cl3O2 — CID 63567597
1-phenyl-2-(2,4,5-trichlorophenoxy)butan-1-one (PubChem CID 63567597) has the molecular formula C16H13Cl3O2 and a molecular weight of 343.64 g/mol. Its IUPAC name is 1-phenyl-2-(2,4,5-trichlorophenoxy)butan-1-one.
| Compound Name | 1-phenyl-2-(2,4,5-trichlorophenoxy)butan-1-one |
|---|---|
| PubChem CID | 63567597 |
| Molecular Formula | C16H13Cl3O2 |
| Molecular Weight | 343.64 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 1-phenyl-2-(2,4,5-trichlorophenoxy)butan-1-one |
| SMILES | CCC(Oc1cc(Cl)c(Cl)cc1Cl)C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H13Cl3O2/c1-2-14(16(20)10-6-4-3-5-7-10)21-15-9-12(18)11(17)8-13(15)19/h3-9,14H,2H2,1H3 |
| InChIKey | SMTAULIBQDBVMF-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.64 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|