About 1-[4-(chloromethyl)-2-methylphenyl]-2,3-dimethylpiperidine
1-[4-(chloromethyl)-2-methylphenyl]-2,3-dimethylpiperidine (PubChem CID 63567826) has the molecular formula C15H22ClN
and a molecular weight of 251.80 g/mol. Its IUPAC name is 1-[4-(chloromethyl)-2-methylphenyl]-2,3-dimethylpiperidine.
Molecular Properties
| Compound Name | 1-[4-(chloromethyl)-2-methylphenyl]-2,3-dimethylpiperidine |
| PubChem CID | 63567826 |
| Molecular Formula | C15H22ClN |
| Molecular Weight | 251.80 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 1-[4-(chloromethyl)-2-methylphenyl]-2,3-dimethylpiperidine |
| SMILES | Cc1cc(CCl)ccc1N1CCCC(C)C1C |
| InChI | InChI=1S/C15H22ClN/c1-11-5-4-8-17(13(11)3)15-7-6-14(10-16)9-12(15)2/h6-7,9,11,13H,4-5,8,10H2,1-3H3 |
| InChIKey | CTUTUWQPCANDMU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.80 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(chloromethyl)-2-methylphenyl]-2,3-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(chloromethyl)-2-methylphenyl]-2,3-dimethylpiperidine?
The IUPAC name of 1-[4-(chloromethyl)-2-methylphenyl]-2,3-dimethylpiperidine (CID 63567826) is 1-[4-(chloromethyl)-2-methylphenyl]-2,3-dimethylpiperidine.
What is the SMILES notation for 1-[4-(chloromethyl)-2-methylphenyl]-2,3-dimethylpiperidine?
The canonical SMILES for 1-[4-(chloromethyl)-2-methylphenyl]-2,3-dimethylpiperidine is Cc1cc(CCl)ccc1N1CCCC(C)C1C.
What is the InChIKey of 1-[4-(chloromethyl)-2-methylphenyl]-2,3-dimethylpiperidine?
The InChIKey is CTUTUWQPCANDMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22ClN/c1-11-5-4-8-17(13(11)3)15-7-6-14(10-16)9-12(15)2/h6-7,9,11,13H,4-5,8,10H2,1-3H3.
What are the key properties of 1-[4-(chloromethyl)-2-methylphenyl]-2,3-dimethylpiperidine?
1-[4-(chloromethyl)-2-methylphenyl]-2,3-dimethylpiperidine has a molecular weight of 251.80 g/mol, XLogP of 4.36, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(chloromethyl)-2-methylphenyl]-2,3-dimethylpiperidine is sourced from PubChem (CID 63567826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).