C11H17N3O2 — CID 63568851
3-(piperidin-1-ylmethyl)furan-2-carbohydrazide (PubChem CID 63568851) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is 3-(piperidin-1-ylmethyl)furan-2-carbohydrazide.
| Compound Name | 3-(piperidin-1-ylmethyl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 63568851 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | 3-(piperidin-1-ylmethyl)furan-2-carbohydrazide |
| SMILES | NNC(=O)c1occc1CN1CCCCC1 |
| InChI | InChI=1S/C11H17N3O2/c12-13-11(15)10-9(4-7-16-10)8-14-5-2-1-3-6-14/h4,7H,1-3,5-6,8,12H2,(H,13,15) |
| InChIKey | AJSSNVBTLFMACL-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|