C9H6F3N3O2 — CID 63569285
2-(2-cyano-3-fluorophenoxy)-2,2-difluoroacetohydrazide (PubChem CID 63569285) has the molecular formula C9H6F3N3O2 and a molecular weight of 245.16 g/mol. Its IUPAC name is 2-(2-cyano-3-fluorophenoxy)-2,2-difluoroacetohydrazide.
| Compound Name | 2-(2-cyano-3-fluorophenoxy)-2,2-difluoroacetohydrazide |
|---|---|
| PubChem CID | 63569285 |
| Molecular Formula | C9H6F3N3O2 |
| Molecular Weight | 245.16 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 2-(2-cyano-3-fluorophenoxy)-2,2-difluoroacetohydrazide |
| SMILES | N#Cc1c(F)cccc1OC(F)(F)C(=O)NN |
| InChI | InChI=1S/C9H6F3N3O2/c10-6-2-1-3-7(5(6)4-13)17-9(11,12)8(16)15-14/h1-3H,14H2,(H,15,16) |
| InChIKey | PQAWJVNFIUSZRY-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.16 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|