C13H17N5O2 — CID 63569793
1-[2-(2-ethylphenoxy)ethyl]triazole-4-carbohydrazide (PubChem CID 63569793) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 1-[2-(2-ethylphenoxy)ethyl]triazole-4-carbohydrazide.
| Compound Name | 1-[2-(2-ethylphenoxy)ethyl]triazole-4-carbohydrazide |
|---|---|
| PubChem CID | 63569793 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 1-[2-(2-ethylphenoxy)ethyl]triazole-4-carbohydrazide |
| SMILES | CCc1ccccc1OCCn1cc(C(=O)NN)nn1 |
| InChI | InChI=1S/C13H17N5O2/c1-2-10-5-3-4-6-12(10)20-8-7-18-9-11(16-17-18)13(19)15-14/h3-6,9H,2,7-8,14H2,1H3,(H,15,19) |
| InChIKey | DILCGYRIRFKLPY-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|