C11H14N4O — CID 63570453
2-[N-(2-cyanoethyl)anilino]acetohydrazide (PubChem CID 63570453) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-[N-(2-cyanoethyl)anilino]acetohydrazide.
| Compound Name | 2-[N-(2-cyanoethyl)anilino]acetohydrazide |
|---|---|
| PubChem CID | 63570453 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 2-[N-(2-cyanoethyl)anilino]acetohydrazide |
| SMILES | N#CCCN(CC(=O)NN)c1ccccc1 |
| InChI | InChI=1S/C11H14N4O/c12-7-4-8-15(9-11(16)14-13)10-5-2-1-3-6-10/h1-3,5-6H,4,8-9,13H2,(H,14,16) |
| InChIKey | VBUVKAVMQHFVOY-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 82.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|