About 4-(1,1-dioxo-1,4-thiazinan-4-yl)pentanehydrazide
4-(1,1-dioxo-1,4-thiazinan-4-yl)pentanehydrazide (PubChem CID 63571628) has the molecular formula C9H19N3O3S
and a molecular weight of 249.34 g/mol. Its IUPAC name is 4-(1,1-dioxo-1,4-thiazinan-4-yl)pentanehydrazide.
Molecular Properties
| Compound Name | 4-(1,1-dioxo-1,4-thiazinan-4-yl)pentanehydrazide |
| PubChem CID | 63571628 |
| Molecular Formula | C9H19N3O3S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 4-(1,1-dioxo-1,4-thiazinan-4-yl)pentanehydrazide |
| SMILES | CC(CCC(=O)NN)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C9H19N3O3S/c1-8(2-3-9(13)11-10)12-4-6-16(14,15)7-5-12/h8H,2-7,10H2,1H3,(H,11,13) |
| InChIKey | UWVXJMUCVPOKLM-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,1-dioxo-1,4-thiazinan-4-yl)pentanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,1-dioxo-1,4-thiazinan-4-yl)pentanehydrazide?
The IUPAC name of 4-(1,1-dioxo-1,4-thiazinan-4-yl)pentanehydrazide (CID 63571628) is 4-(1,1-dioxo-1,4-thiazinan-4-yl)pentanehydrazide.
What is the SMILES notation for 4-(1,1-dioxo-1,4-thiazinan-4-yl)pentanehydrazide?
The canonical SMILES for 4-(1,1-dioxo-1,4-thiazinan-4-yl)pentanehydrazide is CC(CCC(=O)NN)N1CCS(=O)(=O)CC1.
What is the InChIKey of 4-(1,1-dioxo-1,4-thiazinan-4-yl)pentanehydrazide?
The InChIKey is UWVXJMUCVPOKLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N3O3S/c1-8(2-3-9(13)11-10)12-4-6-16(14,15)7-5-12/h8H,2-7,10H2,1H3,(H,11,13).
What are the key properties of 4-(1,1-dioxo-1,4-thiazinan-4-yl)pentanehydrazide?
4-(1,1-dioxo-1,4-thiazinan-4-yl)pentanehydrazide has a molecular weight of 249.34 g/mol, XLogP of -1.12, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,1-dioxo-1,4-thiazinan-4-yl)pentanehydrazide is sourced from PubChem (CID 63571628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).