About 1-[2-[methyl(2,2,2-trifluoroethyl)amino]acetyl]piperidine-4-carbohydrazide
1-[2-[methyl(2,2,2-trifluoroethyl)amino]acetyl]piperidine-4-carbohydrazide (PubChem CID 63571650) has the molecular formula C11H19F3N4O2
and a molecular weight of 296.29 g/mol. Its IUPAC name is 1-[2-[methyl(2,2,2-trifluoroethyl)amino]acetyl]piperidine-4-carbohydrazide.
Molecular Properties
| Compound Name | 1-[2-[methyl(2,2,2-trifluoroethyl)amino]acetyl]piperidine-4-carbohydrazide |
| PubChem CID | 63571650 |
| Molecular Formula | C11H19F3N4O2 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 1-[2-[methyl(2,2,2-trifluoroethyl)amino]acetyl]piperidine-4-carbohydrazide |
| SMILES | CN(CC(=O)N1CCC(C(=O)NN)CC1)CC(F)(F)F |
| InChI | InChI=1S/C11H19F3N4O2/c1-17(7-11(12,13)14)6-9(19)18-4-2-8(3-5-18)10(20)16-15/h8H,2-7,15H2,1H3,(H,16,20) |
| InChIKey | FSDKNLLMPYUPGQ-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[methyl(2,2,2-trifluoroethyl)amino]acetyl]piperidine-4-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[methyl(2,2,2-trifluoroethyl)amino]acetyl]piperidine-4-carbohydrazide?
The IUPAC name of 1-[2-[methyl(2,2,2-trifluoroethyl)amino]acetyl]piperidine-4-carbohydrazide (CID 63571650) is 1-[2-[methyl(2,2,2-trifluoroethyl)amino]acetyl]piperidine-4-carbohydrazide.
What is the SMILES notation for 1-[2-[methyl(2,2,2-trifluoroethyl)amino]acetyl]piperidine-4-carbohydrazide?
The canonical SMILES for 1-[2-[methyl(2,2,2-trifluoroethyl)amino]acetyl]piperidine-4-carbohydrazide is CN(CC(=O)N1CCC(C(=O)NN)CC1)CC(F)(F)F.
What is the InChIKey of 1-[2-[methyl(2,2,2-trifluoroethyl)amino]acetyl]piperidine-4-carbohydrazide?
The InChIKey is FSDKNLLMPYUPGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F3N4O2/c1-17(7-11(12,13)14)6-9(19)18-4-2-8(3-5-18)10(20)16-15/h8H,2-7,15H2,1H3,(H,16,20).
What are the key properties of 1-[2-[methyl(2,2,2-trifluoroethyl)amino]acetyl]piperidine-4-carbohydrazide?
1-[2-[methyl(2,2,2-trifluoroethyl)amino]acetyl]piperidine-4-carbohydrazide has a molecular weight of 296.29 g/mol, XLogP of -0.29, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[methyl(2,2,2-trifluoroethyl)amino]acetyl]piperidine-4-carbohydrazide is sourced from PubChem (CID 63571650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).