About 5-[[methyl(2,2,2-trifluoroethyl)amino]methyl]thiophene-2-carbohydrazide
5-[[methyl(2,2,2-trifluoroethyl)amino]methyl]thiophene-2-carbohydrazide (PubChem CID 63571652) has the molecular formula C9H12F3N3OS
and a molecular weight of 267.28 g/mol. Its IUPAC name is 5-[[methyl(2,2,2-trifluoroethyl)amino]methyl]thiophene-2-carbohydrazide.
Molecular Properties
| Compound Name | 5-[[methyl(2,2,2-trifluoroethyl)amino]methyl]thiophene-2-carbohydrazide |
| PubChem CID | 63571652 |
| Molecular Formula | C9H12F3N3OS |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 5-[[methyl(2,2,2-trifluoroethyl)amino]methyl]thiophene-2-carbohydrazide |
| SMILES | CN(Cc1ccc(C(=O)NN)s1)CC(F)(F)F |
| InChI | InChI=1S/C9H12F3N3OS/c1-15(5-9(10,11)12)4-6-2-3-7(17-6)8(16)14-13/h2-3H,4-5,13H2,1H3,(H,14,16) |
| InChIKey | RYKHTAAJUBRZOL-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[[methyl(2,2,2-trifluoroethyl)amino]methyl]thiophene-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[methyl(2,2,2-trifluoroethyl)amino]methyl]thiophene-2-carbohydrazide?
The IUPAC name of 5-[[methyl(2,2,2-trifluoroethyl)amino]methyl]thiophene-2-carbohydrazide (CID 63571652) is 5-[[methyl(2,2,2-trifluoroethyl)amino]methyl]thiophene-2-carbohydrazide.
What is the SMILES notation for 5-[[methyl(2,2,2-trifluoroethyl)amino]methyl]thiophene-2-carbohydrazide?
The canonical SMILES for 5-[[methyl(2,2,2-trifluoroethyl)amino]methyl]thiophene-2-carbohydrazide is CN(Cc1ccc(C(=O)NN)s1)CC(F)(F)F.
What is the InChIKey of 5-[[methyl(2,2,2-trifluoroethyl)amino]methyl]thiophene-2-carbohydrazide?
The InChIKey is RYKHTAAJUBRZOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F3N3OS/c1-15(5-9(10,11)12)4-6-2-3-7(17-6)8(16)14-13/h2-3H,4-5,13H2,1H3,(H,14,16).
What are the key properties of 5-[[methyl(2,2,2-trifluoroethyl)amino]methyl]thiophene-2-carbohydrazide?
5-[[methyl(2,2,2-trifluoroethyl)amino]methyl]thiophene-2-carbohydrazide has a molecular weight of 267.28 g/mol, XLogP of 1.35, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[methyl(2,2,2-trifluoroethyl)amino]methyl]thiophene-2-carbohydrazide is sourced from PubChem (CID 63571652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).