C10H11N3O4 — CID 63571860
5-[(2,5-dioxopyrrolidin-1-yl)methyl]furan-3-carbohydrazide (PubChem CID 63571860) has the molecular formula C10H11N3O4 and a molecular weight of 237.21 g/mol. Its IUPAC name is 5-[(2,5-dioxopyrrolidin-1-yl)methyl]furan-3-carbohydrazide.
| Compound Name | 5-[(2,5-dioxopyrrolidin-1-yl)methyl]furan-3-carbohydrazide |
|---|---|
| PubChem CID | 63571860 |
| Molecular Formula | C10H11N3O4 |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 5-[(2,5-dioxopyrrolidin-1-yl)methyl]furan-3-carbohydrazide |
| SMILES | NNC(=O)c1coc(CN2C(=O)CCC2=O)c1 |
| InChI | InChI=1S/C10H11N3O4/c11-12-10(16)6-3-7(17-5-6)4-13-8(14)1-2-9(13)15/h3,5H,1-2,4,11H2,(H,12,16) |
| InChIKey | CIAMEMJMXNHISJ-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|