C11H23N3O2 — CID 63571893
3-[2-(3-hydroxypropyl)pyrrolidin-1-yl]-2-methylpropanehydrazide (PubChem CID 63571893) has the molecular formula C11H23N3O2 and a molecular weight of 229.32 g/mol. Its IUPAC name is 3-[2-(3-hydroxypropyl)pyrrolidin-1-yl]-2-methylpropanehydrazide.
| Compound Name | 3-[2-(3-hydroxypropyl)pyrrolidin-1-yl]-2-methylpropanehydrazide |
|---|---|
| PubChem CID | 63571893 |
| Molecular Formula | C11H23N3O2 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 3-[2-(3-hydroxypropyl)pyrrolidin-1-yl]-2-methylpropanehydrazide |
| SMILES | CC(CN1CCCC1CCCO)C(=O)NN |
| InChI | InChI=1S/C11H23N3O2/c1-9(11(16)13-12)8-14-6-2-4-10(14)5-3-7-15/h9-10,15H,2-8,12H2,1H3,(H,13,16) |
| InChIKey | APOVNCSPNQGEPD-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|