C11H24N4O — CID 63572438
2-methyl-3-[methyl-(1-methylpiperidin-3-yl)amino]propanehydrazide (PubChem CID 63572438) has the molecular formula C11H24N4O and a molecular weight of 228.34 g/mol. Its IUPAC name is 2-methyl-3-[methyl-(1-methylpiperidin-3-yl)amino]propanehydrazide.
| Compound Name | 2-methyl-3-[methyl-(1-methylpiperidin-3-yl)amino]propanehydrazide |
|---|---|
| PubChem CID | 63572438 |
| Molecular Formula | C11H24N4O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.20 |
| IUPAC Name | 2-methyl-3-[methyl-(1-methylpiperidin-3-yl)amino]propanehydrazide |
| SMILES | CC(CN(C)C1CCCN(C)C1)C(=O)NN |
| InChI | InChI=1S/C11H24N4O/c1-9(11(16)13-12)7-15(3)10-5-4-6-14(2)8-10/h9-10H,4-8,12H2,1-3H3,(H,13,16) |
| InChIKey | DYSQRVVLZNYQQS-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|