C11H20N4O2 — CID 63572716
5-[[butan-2-yl(ethyl)amino]methyl]-1,2-oxazole-3-carbohydrazide (PubChem CID 63572716) has the molecular formula C11H20N4O2 and a molecular weight of 240.31 g/mol. Its IUPAC name is 5-[[butan-2-yl(ethyl)amino]methyl]-1,2-oxazole-3-carbohydrazide.
| Compound Name | 5-[[butan-2-yl(ethyl)amino]methyl]-1,2-oxazole-3-carbohydrazide |
|---|---|
| PubChem CID | 63572716 |
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 5-[[butan-2-yl(ethyl)amino]methyl]-1,2-oxazole-3-carbohydrazide |
| SMILES | CCC(C)N(CC)Cc1cc(C(=O)NN)no1 |
| InChI | InChI=1S/C11H20N4O2/c1-4-8(3)15(5-2)7-9-6-10(14-17-9)11(16)13-12/h6,8H,4-5,7,12H2,1-3H3,(H,13,16) |
| InChIKey | UAMAWNARKUCBDA-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|