About 2-(3,6-dioxo-1H-pyridazin-2-yl)propanehydrazide
2-(3,6-dioxo-1H-pyridazin-2-yl)propanehydrazide (PubChem CID 63572992) has the molecular formula C7H10N4O3
and a molecular weight of 198.18 g/mol. Its IUPAC name is 2-(3,6-dioxo-1H-pyridazin-2-yl)propanehydrazide.
Molecular Properties
| Compound Name | 2-(3,6-dioxo-1H-pyridazin-2-yl)propanehydrazide |
| PubChem CID | 63572992 |
| Molecular Formula | C7H10N4O3 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 2-(3,6-dioxo-1H-pyridazin-2-yl)propanehydrazide |
| SMILES | CC(C(=O)NN)n1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C7H10N4O3/c1-4(7(14)9-8)11-6(13)3-2-5(12)10-11/h2-4H,8H2,1H3,(H,9,14)(H,10,12) |
| InChIKey | XAHHEWMLZMTUOK-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,6-dioxo-1H-pyridazin-2-yl)propanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,6-dioxo-1H-pyridazin-2-yl)propanehydrazide?
The IUPAC name of 2-(3,6-dioxo-1H-pyridazin-2-yl)propanehydrazide (CID 63572992) is 2-(3,6-dioxo-1H-pyridazin-2-yl)propanehydrazide.
What is the SMILES notation for 2-(3,6-dioxo-1H-pyridazin-2-yl)propanehydrazide?
The canonical SMILES for 2-(3,6-dioxo-1H-pyridazin-2-yl)propanehydrazide is CC(C(=O)NN)n1[nH]c(=O)ccc1=O.
What is the InChIKey of 2-(3,6-dioxo-1H-pyridazin-2-yl)propanehydrazide?
The InChIKey is XAHHEWMLZMTUOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O3/c1-4(7(14)9-8)11-6(13)3-2-5(12)10-11/h2-4H,8H2,1H3,(H,9,14)(H,10,12).
What are the key properties of 2-(3,6-dioxo-1H-pyridazin-2-yl)propanehydrazide?
2-(3,6-dioxo-1H-pyridazin-2-yl)propanehydrazide has a molecular weight of 198.18 g/mol, XLogP of -1.91, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,6-dioxo-1H-pyridazin-2-yl)propanehydrazide is sourced from PubChem (CID 63572992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).