C14H23N3O3 — CID 63573018
5-[(4-ethoxypiperidin-1-yl)methyl]-2-methylfuran-3-carbohydrazide (PubChem CID 63573018) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is 5-[(4-ethoxypiperidin-1-yl)methyl]-2-methylfuran-3-carbohydrazide.
| Compound Name | 5-[(4-ethoxypiperidin-1-yl)methyl]-2-methylfuran-3-carbohydrazide |
|---|---|
| PubChem CID | 63573018 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 5-[(4-ethoxypiperidin-1-yl)methyl]-2-methylfuran-3-carbohydrazide |
| SMILES | CCOC1CCN(Cc2cc(C(=O)NN)c(C)o2)CC1 |
| InChI | InChI=1S/C14H23N3O3/c1-3-19-11-4-6-17(7-5-11)9-12-8-13(10(2)20-12)14(18)16-15/h8,11H,3-7,9,15H2,1-2H3,(H,16,18) |
| InChIKey | KLPQBWZFOGPHNI-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|