C36H33N3Si3 — CID 635734
2,2,4,4,6,6-hexakis-phenyl-1,3,5,2,4,6-triazatrisilinane (PubChem CID 635734) has the molecular formula C36H33N3Si3 and a molecular weight of 591.94 g/mol. Its IUPAC name is 2,2,4,4,6,6-hexakis-phenyl-1,3,5,2,4,6-triazatrisilinane.
| Compound Name | 2,2,4,4,6,6-hexakis-phenyl-1,3,5,2,4,6-triazatrisilinane |
|---|---|
| PubChem CID | 635734 |
| Molecular Formula | C36H33N3Si3 |
| Molecular Weight | 591.94 g/mol |
| Exact Mass | 591.20 |
| IUPAC Name | 2,2,4,4,6,6-hexakis-phenyl-1,3,5,2,4,6-triazatrisilinane |
| SMILES | c1ccc([Si]2(c3ccccc3)N[Si](c3ccccc3)(c3ccccc3)N[Si](c3ccccc3)(c3ccccc3)N2)cc1 |
| InChI | InChI=1S/C36H33N3Si3/c1-7-19-31(20-8-1)40(32-21-9-2-10-22-32)37-41(33-23-11-3-12-24-33,34-25-13-4-14-26-34)39-42(38-40,35-27-15-5-16-28-35)36-29-17-6-18-30-36/h1-30,37-39H |
| InChIKey | SHWQWXGIWFEYTA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.94 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|