C9H20N4O — CID 63573409
2-[methyl(2-pyrrolidin-1-ylethyl)amino]acetohydrazide (PubChem CID 63573409) has the molecular formula C9H20N4O and a molecular weight of 200.29 g/mol. Its IUPAC name is 2-[methyl(2-pyrrolidin-1-ylethyl)amino]acetohydrazide.
| Compound Name | 2-[methyl(2-pyrrolidin-1-ylethyl)amino]acetohydrazide |
|---|---|
| PubChem CID | 63573409 |
| Molecular Formula | C9H20N4O |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 2-[methyl(2-pyrrolidin-1-ylethyl)amino]acetohydrazide |
| SMILES | CN(CCN1CCCC1)CC(=O)NN |
| InChI | InChI=1S/C9H20N4O/c1-12(8-9(14)11-10)6-7-13-4-2-3-5-13/h2-8,10H2,1H3,(H,11,14) |
| InChIKey | UJBGZIKKSYMMOP-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|