C12H17N5O4 — CID 63573551
1-[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]piperidine-4-carbohydrazide (PubChem CID 63573551) has the molecular formula C12H17N5O4 and a molecular weight of 295.30 g/mol. Its IUPAC name is 1-[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]piperidine-4-carbohydrazide.
| Compound Name | 1-[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]piperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 63573551 |
| Molecular Formula | C12H17N5O4 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 1-[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]piperidine-4-carbohydrazide |
| SMILES | NNC(=O)C1CCN(C(=O)Cn2[nH]c(=O)ccc2=O)CC1 |
| InChI | InChI=1S/C12H17N5O4/c13-14-12(21)8-3-5-16(6-4-8)11(20)7-17-10(19)2-1-9(18)15-17/h1-2,8H,3-7,13H2,(H,14,21)(H,15,18) |
| InChIKey | OWFQZHRQTZANPU-UHFFFAOYSA-N |
| XLogP | -2.23 |
| TPSA | 130.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|