C15H16N4O2 — CID 63573992
5-[(3-cyano-N-methylanilino)methyl]-2-methylfuran-3-carbohydrazide (PubChem CID 63573992) has the molecular formula C15H16N4O2 and a molecular weight of 284.32 g/mol. Its IUPAC name is 5-[(3-cyano-N-methylanilino)methyl]-2-methylfuran-3-carbohydrazide.
| Compound Name | 5-[(3-cyano-N-methylanilino)methyl]-2-methylfuran-3-carbohydrazide |
|---|---|
| PubChem CID | 63573992 |
| Molecular Formula | C15H16N4O2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 5-[(3-cyano-N-methylanilino)methyl]-2-methylfuran-3-carbohydrazide |
| SMILES | Cc1oc(CN(C)c2cccc(C#N)c2)cc1C(=O)NN |
| InChI | InChI=1S/C15H16N4O2/c1-10-14(15(20)18-17)7-13(21-10)9-19(2)12-5-3-4-11(6-12)8-16/h3-7H,9,17H2,1-2H3,(H,18,20) |
| InChIKey | VDUAVEQICXVTDL-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 95.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|