C15H18N2O3S — CID 63575058
5-[[4-(2-methoxyethyl)phenoxy]methyl]thiophene-2-carbohydrazide (PubChem CID 63575058) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is 5-[[4-(2-methoxyethyl)phenoxy]methyl]thiophene-2-carbohydrazide.
| Compound Name | 5-[[4-(2-methoxyethyl)phenoxy]methyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 63575058 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 5-[[4-(2-methoxyethyl)phenoxy]methyl]thiophene-2-carbohydrazide |
| SMILES | COCCc1ccc(OCc2ccc(C(=O)NN)s2)cc1 |
| InChI | InChI=1S/C15H18N2O3S/c1-19-9-8-11-2-4-12(5-3-11)20-10-13-6-7-14(21-13)15(18)17-16/h2-7H,8-10,16H2,1H3,(H,17,18) |
| InChIKey | QCZMJVFKFVTYJW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|