C11H16N2O4 — CID 63575102
2-(2,6-dimethoxyphenoxy)propanehydrazide (PubChem CID 63575102) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is 2-(2,6-dimethoxyphenoxy)propanehydrazide.
| Compound Name | 2-(2,6-dimethoxyphenoxy)propanehydrazide |
|---|---|
| PubChem CID | 63575102 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 2-(2,6-dimethoxyphenoxy)propanehydrazide |
| SMILES | COc1cccc(OC)c1OC(C)C(=O)NN |
| InChI | InChI=1S/C11H16N2O4/c1-7(11(14)13-12)17-10-8(15-2)5-4-6-9(10)16-3/h4-7H,12H2,1-3H3,(H,13,14) |
| InChIKey | DKVGOLSLBRRDIN-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|