C11H9FN4O4S — CID 63575285
4-[(5-fluoro-2-nitrophenoxy)methyl]-1,3-thiazole-2-carbohydrazide (PubChem CID 63575285) has the molecular formula C11H9FN4O4S and a molecular weight of 312.28 g/mol. Its IUPAC name is 4-[(5-fluoro-2-nitrophenoxy)methyl]-1,3-thiazole-2-carbohydrazide.
| Compound Name | 4-[(5-fluoro-2-nitrophenoxy)methyl]-1,3-thiazole-2-carbohydrazide |
|---|---|
| PubChem CID | 63575285 |
| Molecular Formula | C11H9FN4O4S |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 4-[(5-fluoro-2-nitrophenoxy)methyl]-1,3-thiazole-2-carbohydrazide |
| SMILES | NNC(=O)c1nc(COc2cc(F)ccc2[N+](=O)[O-])cs1 |
| InChI | InChI=1S/C11H9FN4O4S/c12-6-1-2-8(16(18)19)9(3-6)20-4-7-5-21-11(14-7)10(17)15-13/h1-3,5H,4,13H2,(H,15,17) |
| InChIKey | GQMOUOCHWGCJKS-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 120.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|