About 4-(hydroxymethyl)-1,3-thiazole-2-carbohydrazide
4-(hydroxymethyl)-1,3-thiazole-2-carbohydrazide (PubChem CID 63576253) has the molecular formula C5H7N3O2S
and a molecular weight of 173.20 g/mol. Its IUPAC name is 4-(hydroxymethyl)-1,3-thiazole-2-carbohydrazide.
Molecular Properties
| Compound Name | 4-(hydroxymethyl)-1,3-thiazole-2-carbohydrazide |
| PubChem CID | 63576253 |
| Molecular Formula | C5H7N3O2S |
| Molecular Weight | 173.20 g/mol |
| Exact Mass | 173.03 |
| IUPAC Name | 4-(hydroxymethyl)-1,3-thiazole-2-carbohydrazide |
| SMILES | NNC(=O)c1nc(CO)cs1 |
| InChI | InChI=1S/C5H7N3O2S/c6-8-4(10)5-7-3(1-9)2-11-5/h2,9H,1,6H2,(H,8,10) |
| InChIKey | QIXCWLKEXSJGDS-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.20 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(hydroxymethyl)-1,3-thiazole-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(hydroxymethyl)-1,3-thiazole-2-carbohydrazide?
The IUPAC name of 4-(hydroxymethyl)-1,3-thiazole-2-carbohydrazide (CID 63576253) is 4-(hydroxymethyl)-1,3-thiazole-2-carbohydrazide.
What is the SMILES notation for 4-(hydroxymethyl)-1,3-thiazole-2-carbohydrazide?
The canonical SMILES for 4-(hydroxymethyl)-1,3-thiazole-2-carbohydrazide is NNC(=O)c1nc(CO)cs1.
What is the InChIKey of 4-(hydroxymethyl)-1,3-thiazole-2-carbohydrazide?
The InChIKey is QIXCWLKEXSJGDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O2S/c6-8-4(10)5-7-3(1-9)2-11-5/h2,9H,1,6H2,(H,8,10).
What are the key properties of 4-(hydroxymethyl)-1,3-thiazole-2-carbohydrazide?
4-(hydroxymethyl)-1,3-thiazole-2-carbohydrazide has a molecular weight of 173.20 g/mol, XLogP of -0.76, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(hydroxymethyl)-1,3-thiazole-2-carbohydrazide is sourced from PubChem (CID 63576253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).